C21H30O2 — CID 10313566
1-(8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1-(4-methoxyphenyl)ethanol (PubChem CID 10313566) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-(8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1-(4-methoxyphenyl)ethanol.
| Compound Name | 1-(8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1-(4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 10313566 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-(8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1-(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(C(C)(O)C2CCC3=C(C2)C(C)(C)CCC3)cc1 |
| InChI | InChI=1S/C21H30O2/c1-20(2)13-5-6-15-7-8-17(14-19(15)20)21(3,22)16-9-11-18(23-4)12-10-16/h9-12,17,22H,5-8,13-14H2,1-4H3 |
| InChIKey | ZMMIKOIYEGMMDK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|