C14H22O4 — CID 103136129
2-cyclopropyl-3-[(5-methyloxolan-2-yl)methyl]oxolane-3-carboxylic acid (PubChem CID 103136129) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-cyclopropyl-3-[(5-methyloxolan-2-yl)methyl]oxolane-3-carboxylic acid.
| Compound Name | 2-cyclopropyl-3-[(5-methyloxolan-2-yl)methyl]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 103136129 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-cyclopropyl-3-[(5-methyloxolan-2-yl)methyl]oxolane-3-carboxylic acid |
| SMILES | CC1CCC(CC2(C(=O)O)CCOC2C2CC2)O1 |
| InChI | InChI=1S/C14H22O4/c1-9-2-5-11(18-9)8-14(13(15)16)6-7-17-12(14)10-3-4-10/h9-12H,2-8H2,1H3,(H,15,16) |
| InChIKey | ZJYCGFZKVXSNIT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |