C18H34FNO2 — CID 10313632
N-[(E,2S,3R)-3-fluoro-1-hydroxydodec-4-en-2-yl]hexanamide (PubChem CID 10313632) has the molecular formula C18H34FNO2 and a molecular weight of 315.47 g/mol. Its IUPAC name is N-[(E,2S,3R)-3-fluoro-1-hydroxydodec-4-en-2-yl]hexanamide.
| Compound Name | N-[(E,2S,3R)-3-fluoro-1-hydroxydodec-4-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 10313632 |
| Molecular Formula | C18H34FNO2 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | N-[(E,2S,3R)-3-fluoro-1-hydroxydodec-4-en-2-yl]hexanamide |
| SMILES | CCCCCCC/C=C/[C@@H](F)[C@H](CO)NC(=O)CCCCC |
| InChI | InChI=1S/C18H34FNO2/c1-3-5-7-8-9-10-12-13-16(19)17(15-21)20-18(22)14-11-6-4-2/h12-13,16-17,21H,3-11,14-15H2,1-2H3,(H,20,22)/b13-12+/t16-,17+/m1/s1 |
| InChIKey | MTHULKGLWWMNNJ-DCVVVBLRSA-N |
| XLogP | 4.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|