About 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate
4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate (PubChem CID 10313681) has the molecular formula C15H28N2O5
and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate.
Molecular Properties
| Compound Name | 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate |
| PubChem CID | 10313681 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate |
| SMILES | COC(=O)CC(C(=O)OC(C)C)N(C(=O)NC(C)C)C(C)C |
| InChI | InChI=1S/C15H28N2O5/c1-9(2)16-15(20)17(10(3)4)12(8-13(18)21-7)14(19)22-11(5)6/h9-12H,8H2,1-7H3,(H,16,20) |
| InChIKey | UQOONVDFIHNNOQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate?
The IUPAC name of 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate (CID 10313681) is 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate.
What is the SMILES notation for 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate?
The canonical SMILES for 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate is COC(=O)CC(C(=O)OC(C)C)N(C(=O)NC(C)C)C(C)C.
What is the InChIKey of 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate?
The InChIKey is UQOONVDFIHNNOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O5/c1-9(2)16-15(20)17(10(3)4)12(8-13(18)21-7)14(19)22-11(5)6/h9-12H,8H2,1-7H3,(H,16,20).
What are the key properties of 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate?
4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate has a molecular weight of 316.40 g/mol, XLogP of 1.70, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-methyl 1-O-propan-2-yl 2-[propan-2-yl(propan-2-ylcarbamoyl)amino]butanedioate is sourced from PubChem (CID 10313681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).