C13H16N2OS2 — CID 103137131
2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine (PubChem CID 103137131) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 103137131 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine |
| SMILES | CC1CCC(CSc2nc3ccc(N)cc3s2)O1 |
| InChI | InChI=1S/C13H16N2OS2/c1-8-2-4-10(16-8)7-17-13-15-11-5-3-9(14)6-12(11)18-13/h3,5-6,8,10H,2,4,7,14H2,1H3 |
| InChIKey | HHUSMGUPFRBVKS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|