About 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine
2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine (PubChem CID 103137131) has the molecular formula C13H16N2OS2
and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine |
| PubChem CID | 103137131 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine |
| SMILES | CC1CCC(CSc2nc3ccc(N)cc3s2)O1 |
| InChI | InChI=1S/C13H16N2OS2/c1-8-2-4-10(16-8)7-17-13-15-11-5-3-9(14)6-12(11)18-13/h3,5-6,8,10H,2,4,7,14H2,1H3 |
| InChIKey | HHUSMGUPFRBVKS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine?
The IUPAC name of 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine (CID 103137131) is 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine is CC1CCC(CSc2nc3ccc(N)cc3s2)O1.
What is the InChIKey of 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine?
The InChIKey is HHUSMGUPFRBVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS2/c1-8-2-4-10(16-8)7-17-13-15-11-5-3-9(14)6-12(11)18-13/h3,5-6,8,10H,2,4,7,14H2,1H3.
What are the key properties of 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine?
2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine has a molecular weight of 280.42 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyloxolan-2-yl)methylsulfanyl]-1,3-benzothiazol-6-amine is sourced from PubChem (CID 103137131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).