About 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine
8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine (PubChem CID 103138139) has the molecular formula C16H22N4
and a molecular weight of 270.38 g/mol. Its IUPAC name is 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine.
Molecular Properties
| Compound Name | 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine |
| PubChem CID | 103138139 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine |
| SMILES | CN1CCCC(N(C)c2ccc(N)c3ccncc23)C1 |
| InChI | InChI=1S/C16H22N4/c1-19-9-3-4-12(11-19)20(2)16-6-5-15(17)13-7-8-18-10-14(13)16/h5-8,10,12H,3-4,9,11,17H2,1-2H3 |
| InChIKey | VSZHGVJMZIMKFB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine?
The IUPAC name of 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine (CID 103138139) is 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine.
What is the SMILES notation for 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine?
The canonical SMILES for 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine is CN1CCCC(N(C)c2ccc(N)c3ccncc23)C1.
What is the InChIKey of 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine?
The InChIKey is VSZHGVJMZIMKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4/c1-19-9-3-4-12(11-19)20(2)16-6-5-15(17)13-7-8-18-10-14(13)16/h5-8,10,12H,3-4,9,11,17H2,1-2H3.
What are the key properties of 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine?
8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine has a molecular weight of 270.38 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-methyl-8-N-(1-methylpiperidin-3-yl)isoquinoline-5,8-diamine is sourced from PubChem (CID 103138139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).