About lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole
lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole (PubChem CID 10313912) has the molecular formula C15H16Cl2LiNO2
and a molecular weight of 320.14 g/mol. Its IUPAC name is lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole |
| PubChem CID | 10313912 |
| Molecular Formula | C15H16Cl2LiNO2 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCCCOc2c(Cl)c[c-]cc2Cl)on1.[Li+] |
| InChI | InChI=1S/C15H16Cl2NO2.Li/c1-11-10-12(20-18-11)6-3-2-4-9-19-15-13(16)7-5-8-14(15)17;/h7-8,10H,2-4,6,9H2,1H3;/q-1;+1 |
| InChIKey | USIAOPBITHOSKB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole?
The IUPAC name of lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole (CID 10313912) is lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole.
What is the SMILES notation for lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole?
The canonical SMILES for lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole is Cc1cc(CCCCCOc2c(Cl)c[c-]cc2Cl)on1.[Li+].
What is the InChIKey of lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole?
The InChIKey is USIAOPBITHOSKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2NO2.Li/c1-11-10-12(20-18-11)6-3-2-4-9-19-15-13(16)7-5-8-14(15)17;/h7-8,10H,2-4,6,9H2,1H3;/q-1;+1.
What are the key properties of lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole?
lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole has a molecular weight of 320.14 g/mol, XLogP of 1.89, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 5-[5-(2,6-dichlorobenzene-4-id-1-yl)oxypentyl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 10313912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).