C17H21NO2 — CID 103139647
isoquinolin-8-yl-(2,4,5-trimethyloxolan-3-yl)methanol (PubChem CID 103139647) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is isoquinolin-8-yl-(2,4,5-trimethyloxolan-3-yl)methanol.
| Compound Name | isoquinolin-8-yl-(2,4,5-trimethyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 103139647 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | isoquinolin-8-yl-(2,4,5-trimethyloxolan-3-yl)methanol |
| SMILES | CC1OC(C)C(C(O)c2cccc3ccncc23)C1C |
| InChI | InChI=1S/C17H21NO2/c1-10-11(2)20-12(3)16(10)17(19)14-6-4-5-13-7-8-18-9-15(13)14/h4-12,16-17,19H,1-3H3 |
| InChIKey | QKMHMTYUXAIZMH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |