C11H22BrNO — CID 103139985
1-bromo-N,2-dimethyl-N-[(5-methyloxolan-2-yl)methyl]propan-2-amine (PubChem CID 103139985) has the molecular formula C11H22BrNO and a molecular weight of 264.21 g/mol. Its IUPAC name is 1-bromo-N,2-dimethyl-N-[(5-methyloxolan-2-yl)methyl]propan-2-amine.
| Compound Name | 1-bromo-N,2-dimethyl-N-[(5-methyloxolan-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 103139985 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-bromo-N,2-dimethyl-N-[(5-methyloxolan-2-yl)methyl]propan-2-amine |
| SMILES | CC1CCC(CN(C)C(C)(C)CBr)O1 |
| InChI | InChI=1S/C11H22BrNO/c1-9-5-6-10(14-9)7-13(4)11(2,3)8-12/h9-10H,5-8H2,1-4H3 |
| InChIKey | INNRDADJRBBPKF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|