About 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine
3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine (PubChem CID 10314006) has the molecular formula C20H23N3O
and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 10314006 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1cc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H23N3O/c1-22(2)14-9-15-24-20-16-19(17-10-5-3-6-11-17)23(21-20)18-12-7-4-8-13-18/h3-8,10-13,16H,9,14-15H2,1-2H3 |
| InChIKey | KMUHJPGOMYFEPW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine (CID 10314006) is 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine is CN(C)CCCOc1cc(-c2ccccc2)n(-c2ccccc2)n1.
What is the InChIKey of 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine?
The InChIKey is KMUHJPGOMYFEPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O/c1-22(2)14-9-15-24-20-16-19(17-10-5-3-6-11-17)23(21-20)18-12-7-4-8-13-18/h3-8,10-13,16H,9,14-15H2,1-2H3.
What are the key properties of 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine?
3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine has a molecular weight of 321.42 g/mol, XLogP of 3.87, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,5-diphenylpyrazol-3-yl)oxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 10314006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).