C16H21NO6 — CID 10314104
diethyl (2R,6R)-4,5-dioxo-3-azatricyclo[5.2.2.02,6]undecane-2,6-dicarboxylate (PubChem CID 10314104) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is diethyl (2R,6R)-4,5-dioxo-3-azatricyclo[5.2.2.02,6]undecane-2,6-dicarboxylate.
| Compound Name | diethyl (2R,6R)-4,5-dioxo-3-azatricyclo[5.2.2.02,6]undecane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10314104 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | diethyl (2R,6R)-4,5-dioxo-3-azatricyclo[5.2.2.02,6]undecane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12C(=O)C(=O)N[C@]1(C(=O)OCC)C1CCC2CC1 |
| InChI | InChI=1S/C16H21NO6/c1-3-22-13(20)15-9-5-7-10(8-6-9)16(15,14(21)23-4-2)17-12(19)11(15)18/h9-10H,3-8H2,1-2H3,(H,17,19)/t9?,10?,15-,16+/m1/s1 |
| InChIKey | MWDNUSLBLTXLOL-BPRQEBPCSA-N |
| XLogP | 0.36 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|