About 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine
5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine (PubChem CID 103141533) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine.
Molecular Properties
| Compound Name | 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine |
| PubChem CID | 103141533 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine |
| SMILES | CC1CCC(CN2CC(C)(C3CC3)NCC2(C)C)O1 |
| InChI | InChI=1S/C16H30N2O/c1-12-5-8-14(19-12)9-18-11-16(4,13-6-7-13)17-10-15(18,2)3/h12-14,17H,5-11H2,1-4H3 |
| InChIKey | VREMSBFLSFZYID-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine?
The IUPAC name of 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine (CID 103141533) is 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine.
What is the SMILES notation for 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine?
The canonical SMILES for 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine is CC1CCC(CN2CC(C)(C3CC3)NCC2(C)C)O1.
What is the InChIKey of 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine?
The InChIKey is VREMSBFLSFZYID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O/c1-12-5-8-14(19-12)9-18-11-16(4,13-6-7-13)17-10-15(18,2)3/h12-14,17H,5-11H2,1-4H3.
What are the key properties of 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine?
5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine has a molecular weight of 266.43 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2,2,5-trimethyl-1-[(5-methyloxolan-2-yl)methyl]piperazine is sourced from PubChem (CID 103141533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).