C14H18N4O2 — CID 103142168
2-N-(5-nitroisoquinolin-8-yl)pentane-1,2-diamine (PubChem CID 103142168) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-N-(5-nitroisoquinolin-8-yl)pentane-1,2-diamine.
| Compound Name | 2-N-(5-nitroisoquinolin-8-yl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 103142168 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-N-(5-nitroisoquinolin-8-yl)pentane-1,2-diamine |
| SMILES | CCCC(CN)Nc1ccc([N+](=O)[O-])c2ccncc12 |
| InChI | InChI=1S/C14H18N4O2/c1-2-3-10(8-15)17-13-4-5-14(18(19)20)11-6-7-16-9-12(11)13/h4-7,9-10,17H,2-3,8,15H2,1H3 |
| InChIKey | YQEHSPIYAMZKKJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|