C11H18N4O2 — CID 103142774
2-[(5-methyloxolan-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 103142774) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(5-methyloxolan-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[(5-methyloxolan-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 103142774 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-[(5-methyloxolan-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CC1CCC(Cn2nc3n(c2=O)CCNC3)O1 |
| InChI | InChI=1S/C11H18N4O2/c1-8-2-3-9(17-8)7-15-11(16)14-5-4-12-6-10(14)13-15/h8-9,12H,2-7H2,1H3 |
| InChIKey | LSTBGDIQOBGVNX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |