C17H20N2O — CID 103143064
1-isoquinolin-8-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol (PubChem CID 103143064) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-isoquinolin-8-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol.
| Compound Name | 1-isoquinolin-8-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol |
|---|---|
| PubChem CID | 103143064 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-isoquinolin-8-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol |
| SMILES | OC1(c2cccc3ccncc23)CCN2CCCCC21 |
| InChI | InChI=1S/C17H20N2O/c20-17(8-11-19-10-2-1-6-16(17)19)15-5-3-4-13-7-9-18-12-14(13)15/h3-5,7,9,12,16,20H,1-2,6,8,10-11H2 |
| InChIKey | OPEBCTHUOHWILY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |