C11H7F2NO — CID 103143371
2,2-difluoro-1-isoquinolin-8-ylethanone (PubChem CID 103143371) has the molecular formula C11H7F2NO and a molecular weight of 207.18 g/mol. Its IUPAC name is 2,2-difluoro-1-isoquinolin-8-ylethanone.
| Compound Name | 2,2-difluoro-1-isoquinolin-8-ylethanone |
|---|---|
| PubChem CID | 103143371 |
| Molecular Formula | C11H7F2NO |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2,2-difluoro-1-isoquinolin-8-ylethanone |
| SMILES | O=C(c1cccc2ccncc12)C(F)F |
| InChI | InChI=1S/C11H7F2NO/c12-11(13)10(15)8-3-1-2-7-4-5-14-6-9(7)8/h1-6,11H |
| InChIKey | BORFAKXJMHYJKC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |