C17H21N3O — CID 103143671
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(isoquinolin-8-yl)methanamine (PubChem CID 103143671) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(isoquinolin-8-yl)methanamine.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(isoquinolin-8-yl)methanamine |
|---|---|
| PubChem CID | 103143671 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(isoquinolin-8-yl)methanamine |
| SMILES | NC(c1cccc2ccncc12)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C17H21N3O/c18-17(16-10-20-8-2-4-13(20)11-21-16)14-5-1-3-12-6-7-19-9-15(12)14/h1,3,5-7,9,13,16-17H,2,4,8,10-11,18H2 |
| InChIKey | NVCJFTWPINJNJP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |