About (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate
(6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate (PubChem CID 10314426) has the molecular formula C21H16N2O2
and a molecular weight of 328.37 g/mol. Its IUPAC name is (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate.
Molecular Properties
| Compound Name | (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate |
| PubChem CID | 10314426 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate |
| SMILES | CC(=O)Oc1c(-c2ccccc2)c(-c2ccccc2)n2ncccc12 |
| InChI | InChI=1S/C21H16N2O2/c1-15(24)25-21-18-13-8-14-22-23(18)20(17-11-6-3-7-12-17)19(21)16-9-4-2-5-10-16/h2-14H,1H3 |
| InChIKey | IQWJITMJTXMVPQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate?
The IUPAC name of (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate (CID 10314426) is (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate.
What is the SMILES notation for (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate?
The canonical SMILES for (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate is CC(=O)Oc1c(-c2ccccc2)c(-c2ccccc2)n2ncccc12.
What is the InChIKey of (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate?
The InChIKey is IQWJITMJTXMVPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2/c1-15(24)25-21-18-13-8-14-22-23(18)20(17-11-6-3-7-12-17)19(21)16-9-4-2-5-10-16/h2-14H,1H3.
What are the key properties of (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate?
(6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate has a molecular weight of 328.37 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-diphenylpyrrolo[1,2-b]pyridazin-5-yl) acetate is sourced from PubChem (CID 10314426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).