About 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine
3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine (PubChem CID 103144312) has the molecular formula C15H14N4
and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine.
Molecular Properties
| Compound Name | 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine |
| PubChem CID | 103144312 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine |
| SMILES | Cc1nc(N)c(-c2cccc3ccncc23)nc1C |
| InChI | InChI=1S/C15H14N4/c1-9-10(2)19-15(16)14(18-9)12-5-3-4-11-6-7-17-8-13(11)12/h3-8H,1-2H3,(H2,16,19) |
| InChIKey | VIOIHLXCRVEXFW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine?
The IUPAC name of 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine (CID 103144312) is 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine.
What is the SMILES notation for 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine?
The canonical SMILES for 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine is Cc1nc(N)c(-c2cccc3ccncc23)nc1C.
What is the InChIKey of 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine?
The InChIKey is VIOIHLXCRVEXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4/c1-9-10(2)19-15(16)14(18-9)12-5-3-4-11-6-7-17-8-13(11)12/h3-8H,1-2H3,(H2,16,19).
What are the key properties of 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine?
3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine has a molecular weight of 250.30 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isoquinolin-8-yl-5,6-dimethylpyrazin-2-amine is sourced from PubChem (CID 103144312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).