C19H36O4 — CID 10314468
[(2R)-2-[(4S,5R,6R)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]butyl] 2,2-dimethylpropanoate (PubChem CID 10314468) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is [(2R)-2-[(4S,5R,6R)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]butyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-[(4S,5R,6R)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]butyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10314468 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | [(2R)-2-[(4S,5R,6R)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]butyl] 2,2-dimethylpropanoate |
| SMILES | CCC[C@H]1OC(C)(C)O[C@@H]([C@H](CC)COC(=O)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C19H36O4/c1-9-11-15-13(3)16(23-19(7,8)22-15)14(10-2)12-21-17(20)18(4,5)6/h13-16H,9-12H2,1-8H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | XRDRRGUDEKAZRB-KLHDSHLOSA-N |
| XLogP | 4.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |