C14H18N2O2 — CID 103145261
1-(4-amino-2,5-dimethylphenyl)azepane-2,7-dione (PubChem CID 103145261) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(4-amino-2,5-dimethylphenyl)azepane-2,7-dione.
| Compound Name | 1-(4-amino-2,5-dimethylphenyl)azepane-2,7-dione |
|---|---|
| PubChem CID | 103145261 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(4-amino-2,5-dimethylphenyl)azepane-2,7-dione |
| SMILES | Cc1cc(N2C(=O)CCCCC2=O)c(C)cc1N |
| InChI | InChI=1S/C14H18N2O2/c1-9-8-12(10(2)7-11(9)15)16-13(17)5-3-4-6-14(16)18/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | YDDUKEQYUPNUOZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|