C8H11ClF2N2O2 — CID 103145860
5-(2-chloroethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole (PubChem CID 103145860) has the molecular formula C8H11ClF2N2O2 and a molecular weight of 240.64 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole.
| Compound Name | 5-(2-chloroethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103145860 |
| Molecular Formula | C8H11ClF2N2O2 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 5-(2-chloroethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole |
| SMILES | FC(F)COCCc1noc(CCCl)n1 |
| InChI | InChI=1S/C8H11ClF2N2O2/c9-3-1-8-12-7(13-15-8)2-4-14-5-6(10)11/h6H,1-5H2 |
| InChIKey | OOXQDPZAXXEDDZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|