C10H16F3N3O2 — CID 103145971
N-ethyl-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 103145971) has the molecular formula C10H16F3N3O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is N-ethyl-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | N-ethyl-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103145971 |
| Molecular Formula | C10H16F3N3O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-ethyl-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | CCNCCc1nc(CCOCC(F)(F)F)no1 |
| InChI | InChI=1S/C10H16F3N3O2/c1-2-14-5-3-9-15-8(16-18-9)4-6-17-7-10(11,12)13/h14H,2-7H2,1H3 |
| InChIKey | HOMRDIJSYSICBL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|