C8H9F3N6O2 — CID 103145973
5-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 103145973) has the molecular formula C8H9F3N6O2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 5-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 103145973 |
| Molecular Formula | C8H9F3N6O2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 5-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2nc(CCOCC(F)(F)F)no2)n1 |
| InChI | InChI=1S/C8H9F3N6O2/c9-8(10,11)3-18-2-1-4-13-6(19-17-4)5-14-7(12)16-15-5/h1-3H2,(H3,12,14,15,16) |
| InChIKey | GEDWSJRDNALRBR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|