C10H14F3N3O3 — CID 103146146
3-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]oxolan-3-amine (PubChem CID 103146146) has the molecular formula C10H14F3N3O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is 3-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]oxolan-3-amine.
| Compound Name | 3-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 103146146 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
| SMILES | NC1(c2nc(CCOCC(F)(F)F)no2)CCOC1 |
| InChI | InChI=1S/C10H14F3N3O3/c11-10(12,13)6-17-3-1-7-15-8(19-16-7)9(14)2-4-18-5-9/h1-6,14H2 |
| InChIKey | XDPAHFMTVVINLG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|