C11H19F2N3O2 — CID 103146218
(1R)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethylpropan-1-amine (PubChem CID 103146218) has the molecular formula C11H19F2N3O2 and a molecular weight of 263.29 g/mol. Its IUPAC name is (1R)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethylpropan-1-amine.
| Compound Name | (1R)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 103146218 |
| Molecular Formula | C11H19F2N3O2 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (1R)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)[C@@H](N)c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C11H19F2N3O2/c1-11(2,3)9(14)10-15-8(16-18-10)4-5-17-6-7(12)13/h7,9H,4-6,14H2,1-3H3/t9-/m0/s1 |
| InChIKey | DZPCCKWGUVMIDG-VIFPVBQESA-N |
| XLogP | 1.94 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|