C12H19F2N3O2 — CID 103146251
1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine (PubChem CID 103146251) has the molecular formula C12H19F2N3O2 and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine.
| Compound Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 103146251 |
| Molecular Formula | C12H19F2N3O2 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine |
| SMILES | NC1(c2nc(CCOCC(F)F)no2)CCCCC1 |
| InChI | InChI=1S/C12H19F2N3O2/c13-9(14)8-18-7-4-10-16-11(19-17-10)12(15)5-2-1-3-6-12/h9H,1-8,15H2 |
| InChIKey | LZCNNWIFWKEIPL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|