C7H11F2N3O3 — CID 103146266
O-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine (PubChem CID 103146266) has the molecular formula C7H11F2N3O3 and a molecular weight of 223.18 g/mol. Its IUPAC name is O-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine.
| Compound Name | O-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 103146266 |
| Molecular Formula | C7H11F2N3O3 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | O-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine |
| SMILES | NOCc1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C7H11F2N3O3/c8-5(9)3-13-2-1-6-11-7(4-14-10)15-12-6/h5H,1-4,10H2 |
| InChIKey | JHBGKEYXBGMBNE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|