C8H9F2N5O3 — CID 103146384
4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 103146384) has the molecular formula C8H9F2N5O3 and a molecular weight of 261.19 g/mol. Its IUPAC name is 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 103146384 |
| Molecular Formula | C8H9F2N5O3 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C8H9F2N5O3/c9-4(10)3-16-2-1-5-12-8(17-13-5)6-7(11)15-18-14-6/h4H,1-3H2,(H2,11,15) |
| InChIKey | IPLSWXPVXZVVIT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|