C12H19F2N3O3 — CID 103146456
4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethyloxolan-3-amine (PubChem CID 103146456) has the molecular formula C12H19F2N3O3 and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethyloxolan-3-amine.
| Compound Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethyloxolan-3-amine |
|---|---|
| PubChem CID | 103146456 |
| Molecular Formula | C12H19F2N3O3 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethyloxolan-3-amine |
| SMILES | CCNC1COCC1c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C12H19F2N3O3/c1-2-15-9-6-19-5-8(9)12-16-11(17-20-12)3-4-18-7-10(13)14/h8-10,15H,2-7H2,1H3 |
| InChIKey | XXGXLGYCQGKJHS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|