C9H11F3N2O4S — CID 103146461
2-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid (PubChem CID 103146461) has the molecular formula C9H11F3N2O4S and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 103146461 |
| Molecular Formula | C9H11F3N2O4S |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1nc(CCOCC(F)(F)F)no1 |
| InChI | InChI=1S/C9H11F3N2O4S/c10-9(11,12)5-17-2-1-6-13-7(18-14-6)3-19-4-8(15)16/h1-5H2,(H,15,16) |
| InChIKey | PDRCOYHELZGXBS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|