C13H20F2N2O4 — CID 103146500
2-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-2-ethylbutanoic acid (PubChem CID 103146500) has the molecular formula C13H20F2N2O4 and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 103146500 |
| Molecular Formula | C13H20F2N2O4 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Cc1nc(CCOCC(F)F)no1)C(=O)O |
| InChI | InChI=1S/C13H20F2N2O4/c1-3-13(4-2,12(18)19)7-11-16-10(17-21-11)5-6-20-8-9(14)15/h9H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | LUKZKZDGQATQAG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|