C11H14F2N2O4 — CID 103146503
methyl 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboxylate (PubChem CID 103146503) has the molecular formula C11H14F2N2O4 and a molecular weight of 276.24 g/mol. Its IUPAC name is methyl 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 103146503 |
| Molecular Formula | C11H14F2N2O4 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2nc(CCOCC(F)F)no2)CC1 |
| InChI | InChI=1S/C11H14F2N2O4/c1-17-10(16)11(3-4-11)9-14-8(15-19-9)2-5-18-6-7(12)13/h7H,2-6H2,1H3 |
| InChIKey | XFLTUPSPJNRFLE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|