C12H16F3NO3S — CID 103146572
4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 103146572) has the molecular formula C12H16F3NO3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103146572 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)(C)c1nc(CCOCC(F)(F)F)sc1C(=O)O |
| InChI | InChI=1S/C12H16F3NO3S/c1-11(2,3)9-8(10(17)18)20-7(16-9)4-5-19-6-12(13,14)15/h4-6H2,1-3H3,(H,17,18) |
| InChIKey | FITVSKNULMXTTE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|