About 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid
4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 103146577) has the molecular formula C11H13F2NO3S
and a molecular weight of 277.29 g/mol. Its IUPAC name is 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 103146577 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(CCOCC(F)F)nc1C1CC1 |
| InChI | InChI=1S/C11H13F2NO3S/c12-7(13)5-17-4-3-8-14-9(6-1-2-6)10(18-8)11(15)16/h6-7H,1-5H2,(H,15,16) |
| InChIKey | OBRALDWNVOWOLZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid (CID 103146577) is 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid is O=C(O)c1sc(CCOCC(F)F)nc1C1CC1.
What is the InChIKey of 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is OBRALDWNVOWOLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO3S/c12-7(13)5-17-4-3-8-14-9(6-1-2-6)10(18-8)11(15)16/h6-7H,1-5H2,(H,15,16).
What are the key properties of 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid?
4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 277.29 g/mol, XLogP of 2.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 103146577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).