About 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid
2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 103146579) has the molecular formula C12H17F2NO3S
and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 103146579 |
| Molecular Formula | C12H17F2NO3S |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)Cc1nc(CCOCC(F)F)sc1C(=O)O |
| InChI | InChI=1S/C12H17F2NO3S/c1-7(2)5-8-11(12(16)17)19-10(15-8)3-4-18-6-9(13)14/h7,9H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | QXHVDAYQIHCSTD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid (CID 103146579) is 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid is CC(C)Cc1nc(CCOCC(F)F)sc1C(=O)O.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is QXHVDAYQIHCSTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2NO3S/c1-7(2)5-8-11(12(16)17)19-10(15-8)3-4-18-6-9(13)14/h7,9H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid?
2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 293.33 g/mol, XLogP of 2.86, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 103146579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).