C13H18F2N2O3 — CID 103146660
5-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 103146660) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is 5-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146660 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)F)nc(O)c1C1CCCC1 |
| InChI | InChI=1S/C13H18F2N2O3/c14-9(15)7-20-6-5-10-16-12(18)11(13(19)17-10)8-3-1-2-4-8/h8-9H,1-7H2,(H2,16,17,18,19) |
| InChIKey | LLIKAHZTIVCEBN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|