C12H15ClF2N2O — CID 103146687
4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline (PubChem CID 103146687) has the molecular formula C12H15ClF2N2O and a molecular weight of 276.71 g/mol. Its IUPAC name is 4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 103146687 |
| Molecular Formula | C12H15ClF2N2O |
| Molecular Weight | 276.71 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline |
| SMILES | FC(F)COCCc1nc(Cl)c2c(n1)CCCC2 |
| InChI | InChI=1S/C12H15ClF2N2O/c13-12-8-3-1-2-4-9(8)16-11(17-12)5-6-18-7-10(14)15/h10H,1-7H2 |
| InChIKey | ITSFSMIHRMDARC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|