C13H16ClF3N2O — CID 103146690
4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine (PubChem CID 103146690) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine.
| Compound Name | 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
|---|---|
| PubChem CID | 103146690 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
| SMILES | FC(F)(F)COCCc1nc(Cl)c2c(n1)CCCCC2 |
| InChI | InChI=1S/C13H16ClF3N2O/c14-12-9-4-2-1-3-5-10(9)18-11(19-12)6-7-20-8-13(15,16)17/h1-8H2 |
| InChIKey | OCFOMYNUJPQYPO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|