C9H9Cl2F3N2O — CID 103146696
4,6-dichloro-5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine (PubChem CID 103146696) has the molecular formula C9H9Cl2F3N2O and a molecular weight of 289.08 g/mol. Its IUPAC name is 4,6-dichloro-5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine.
| Compound Name | 4,6-dichloro-5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine |
|---|---|
| PubChem CID | 103146696 |
| Molecular Formula | C9H9Cl2F3N2O |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 4,6-dichloro-5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine |
| SMILES | Cc1c(Cl)nc(CCOCC(F)(F)F)nc1Cl |
| InChI | InChI=1S/C9H9Cl2F3N2O/c1-5-7(10)15-6(16-8(5)11)2-3-17-4-9(12,13)14/h2-4H2,1H3 |
| InChIKey | IECORVZZAOZBMX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|