C11H13F3N2O2 — CID 103146954
1-(2-amino-4-methyl-3-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103146954) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-(2-amino-4-methyl-3-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(2-amino-4-methyl-3-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103146954 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(2-amino-4-methyl-3-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | Cc1ccnc(N)c1C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O2/c1-7-2-4-16-10(15)9(7)8(17)3-5-18-6-11(12,13)14/h2,4H,3,5-6H2,1H3,(H2,15,16) |
| InChIKey | CBHCWIIXXYBNKI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|