About 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one
1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103147078) has the molecular formula C9H14F2O2
and a molecular weight of 192.20 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one.
Molecular Properties
| Compound Name | 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one |
| PubChem CID | 103147078 |
| Molecular Formula | C9H14F2O2 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)C1CCC1 |
| InChI | InChI=1S/C9H14F2O2/c10-9(11)6-13-5-4-8(12)7-2-1-3-7/h7,9H,1-6H2 |
| InChIKey | VWCZIINVBMNYAS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one?
The IUPAC name of 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one (CID 103147078) is 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one.
What is the SMILES notation for 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one?
The canonical SMILES for 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one is O=C(CCOCC(F)F)C1CCC1.
What is the InChIKey of 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one?
The InChIKey is VWCZIINVBMNYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O2/c10-9(11)6-13-5-4-8(12)7-2-1-3-7/h7,9H,1-6H2.
What are the key properties of 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one?
1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one has a molecular weight of 192.20 g/mol, XLogP of 2.03, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-one is sourced from PubChem (CID 103147078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).