C19H28N2O3 — CID 10314727
tert-butyl (2R)-3-phenyl-2-[[(2S)-piperidine-2-carbonyl]amino]propanoate (PubChem CID 10314727) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl (2R)-3-phenyl-2-[[(2S)-piperidine-2-carbonyl]amino]propanoate.
| Compound Name | tert-butyl (2R)-3-phenyl-2-[[(2S)-piperidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10314727 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl (2R)-3-phenyl-2-[[(2S)-piperidine-2-carbonyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C19H28N2O3/c1-19(2,3)24-18(23)16(13-14-9-5-4-6-10-14)21-17(22)15-11-7-8-12-20-15/h4-6,9-10,15-16,20H,7-8,11-13H2,1-3H3,(H,21,22)/t15-,16+/m0/s1 |
| InChIKey | HQKNKLSPUROYFC-JKSUJKDBSA-N |
| XLogP | 2.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |