About 5-(2,2-difluoroethoxy)pent-1-en-3-one
5-(2,2-difluoroethoxy)pent-1-en-3-one (PubChem CID 103147273) has the molecular formula C7H10F2O2
and a molecular weight of 164.15 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)pent-1-en-3-one.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethoxy)pent-1-en-3-one |
| PubChem CID | 103147273 |
| Molecular Formula | C7H10F2O2 |
| Molecular Weight | 164.15 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-(2,2-difluoroethoxy)pent-1-en-3-one |
| SMILES | C=CC(=O)CCOCC(F)F |
| InChI | InChI=1S/C7H10F2O2/c1-2-6(10)3-4-11-5-7(8)9/h2,7H,1,3-5H2 |
| InChIKey | PHCYZYYCDFNFJJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-difluoroethoxy)pent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethoxy)pent-1-en-3-one?
The IUPAC name of 5-(2,2-difluoroethoxy)pent-1-en-3-one (CID 103147273) is 5-(2,2-difluoroethoxy)pent-1-en-3-one.
What is the SMILES notation for 5-(2,2-difluoroethoxy)pent-1-en-3-one?
The canonical SMILES for 5-(2,2-difluoroethoxy)pent-1-en-3-one is C=CC(=O)CCOCC(F)F.
What is the InChIKey of 5-(2,2-difluoroethoxy)pent-1-en-3-one?
The InChIKey is PHCYZYYCDFNFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O2/c1-2-6(10)3-4-11-5-7(8)9/h2,7H,1,3-5H2.
What are the key properties of 5-(2,2-difluoroethoxy)pent-1-en-3-one?
5-(2,2-difluoroethoxy)pent-1-en-3-one has a molecular weight of 164.15 g/mol, XLogP of 1.41, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethoxy)pent-1-en-3-one is sourced from PubChem (CID 103147273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).