About 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one
4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one (PubChem CID 103147287) has the molecular formula C9H11F2NO2S
and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one |
| PubChem CID | 103147287 |
| Molecular Formula | C9H11F2NO2S |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one |
| SMILES | O=C(CCOCC(F)F)Cc1nccs1 |
| InChI | InChI=1S/C9H11F2NO2S/c10-8(11)6-14-3-1-7(13)5-9-12-2-4-15-9/h2,4,8H,1,3,5-6H2 |
| InChIKey | SAMDREUBFQLLMW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one?
The IUPAC name of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one (CID 103147287) is 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one.
What is the SMILES notation for 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one?
The canonical SMILES for 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one is O=C(CCOCC(F)F)Cc1nccs1.
What is the InChIKey of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one?
The InChIKey is SAMDREUBFQLLMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2NO2S/c10-8(11)6-14-3-1-7(13)5-9-12-2-4-15-9/h2,4,8H,1,3,5-6H2.
What are the key properties of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one?
4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one has a molecular weight of 235.25 g/mol, XLogP of 1.93, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-2-yl)butan-2-one is sourced from PubChem (CID 103147287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).