C13H21F3N2O2 — CID 103147415
1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-ol (PubChem CID 103147415) has the molecular formula C13H21F3N2O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-ol.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-ol |
|---|---|
| PubChem CID | 103147415 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-ol |
| SMILES | CCC(C)n1ccc(CC(O)CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C13H21F3N2O2/c1-3-10(2)18-6-4-11(17-18)8-12(19)5-7-20-9-13(14,15)16/h4,6,10,12,19H,3,5,7-9H2,1-2H3 |
| InChIKey | OJAWKVIKBROJLP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|