C10H11NO7S — CID 10314754
(2S,5R,6Z)-6-(carboxymethylidene)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 10314754) has the molecular formula C10H11NO7S and a molecular weight of 289.27 g/mol. Its IUPAC name is (2S,5R,6Z)-6-(carboxymethylidene)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6Z)-6-(carboxymethylidene)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 10314754 |
| Molecular Formula | C10H11NO7S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (2S,5R,6Z)-6-(carboxymethylidene)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)/C(=C/C(=O)O)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C10H11NO7S/c1-10(2)6(9(15)16)11-7(14)4(3-5(12)13)8(11)19(10,17)18/h3,6,8H,1-2H3,(H,12,13)(H,15,16)/b4-3-/t6-,8+/m0/s1 |
| InChIKey | BFVDGHQWCMHZCR-YRNGGQEVSA-N |
| XLogP | -1.17 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|