C13H23F3O2 — CID 103147560
1-(3,4-dimethylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 103147560) has the molecular formula C13H23F3O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103147560 |
| Molecular Formula | C13H23F3O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | CC1CCC(C(O)CCOCC(F)(F)F)CC1C |
| InChI | InChI=1S/C13H23F3O2/c1-9-3-4-11(7-10(9)2)12(17)5-6-18-8-13(14,15)16/h9-12,17H,3-8H2,1-2H3 |
| InChIKey | NAHBDBCAEUBULB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|