About 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol
4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol (PubChem CID 103147645) has the molecular formula C9H13F2NO2S
and a molecular weight of 237.27 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol |
| PubChem CID | 103147645 |
| Molecular Formula | C9H13F2NO2S |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol |
| SMILES | OC(CCOCC(F)F)Cc1cncs1 |
| InChI | InChI=1S/C9H13F2NO2S/c10-9(11)5-14-2-1-7(13)3-8-4-12-6-15-8/h4,6-7,9,13H,1-3,5H2 |
| InChIKey | HHZCZZHYWXJRAM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol?
The IUPAC name of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol (CID 103147645) is 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol.
What is the SMILES notation for 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol?
The canonical SMILES for 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol is OC(CCOCC(F)F)Cc1cncs1.
What is the InChIKey of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol?
The InChIKey is HHZCZZHYWXJRAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO2S/c10-9(11)5-14-2-1-7(13)3-8-4-12-6-15-8/h4,6-7,9,13H,1-3,5H2.
What are the key properties of 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol?
4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol has a molecular weight of 237.27 g/mol, XLogP of 1.72, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-ol is sourced from PubChem (CID 103147645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).