C13H22F2N2O2 — CID 103147693
1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2-difluoroethoxy)butan-2-ol (PubChem CID 103147693) has the molecular formula C13H22F2N2O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2-difluoroethoxy)butan-2-ol.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2-difluoroethoxy)butan-2-ol |
|---|---|
| PubChem CID | 103147693 |
| Molecular Formula | C13H22F2N2O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)-4-(2,2-difluoroethoxy)butan-2-ol |
| SMILES | CCC(C)n1ccc(CC(O)CCOCC(F)F)n1 |
| InChI | InChI=1S/C13H22F2N2O2/c1-3-10(2)17-6-4-11(16-17)8-12(18)5-7-19-9-13(14)15/h4,6,10,12-13,18H,3,5,7-9H2,1-2H3 |
| InChIKey | LMZPBQJAQHQTOR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|